cas: 6960-20-9 — see every product listed under this CAS number, including other names
3-Methyl-5-nitropyridine, 95% (CAS 6960-20-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A876806-5g |
| cas | 6960-20-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 616.84 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 393.63 Pln | |
| Fluorochem | 10g | 627.92 Pln | |
| Fluorochem | 25g | 1195.43 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-methyl-5-nitropyridine (CAS 6960-20-9) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 138.12 g/mol. IUPAC name: 3-methyl-5-nitropyridine. InChIKey: OQWXZZCTJZOSGH-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 138.12 g/mol |
| IUPAC name | 3-methyl-5-nitropyridine |
| InChIKey | OQWXZZCTJZOSGH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)