cas: 6960-20-9 — see every product listed under this CAS number, including other names
3-Methyl-5-nitropyridine, 99.96% (CAS 6960-20-9) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 25 g, 1 g, 5 g, 50 g, 10 g, 500 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W015796-100 g |
| cas | 6960-20-9 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 3644.80 Pln | |
| MedChemExpress | 25 g | 1438.90 Pln | |
| MedChemExpress | 1 g | 310.40 Pln | |
| MedChemExpress | 5 g | 551.89 Pln | |
| MedChemExpress | 50 g | 2325.90 Pln | |
| MedChemExpress | 10 g | 793.38 Pln | |
| MedChemExpress | 500 mg | 240.74 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.96% |
3-methyl-5-nitropyridine (CAS 6960-20-9) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 138.12 g/mol. IUPAC name: 3-methyl-5-nitropyridine. InChIKey: OQWXZZCTJZOSGH-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 138.12 g/mol |
| IUPAC name | 3-methyl-5-nitropyridine |
| InChIKey | OQWXZZCTJZOSGH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)