CAS 21436-44-2 appears in our catalog under these names: 3-Methylbenzoic anhydride, 95%, 3-Methylbenzoic anhydride, 97% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g.
(3-methylbenzoyl) 3-methylbenzoate (CAS 21436-44-2) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: (3-methylbenzoyl) 3-methylbenzoate. InChIKey: DGZSQLHPEZFGSI-UHFFFAOYSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (3-methylbenzoyl) 3-methylbenzoate |
| InChIKey | DGZSQLHPEZFGSI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)OC(=O)C2=CC=CC(=C2)C |
Computed by PubChem (NCBI)