CAS 42079-68-5 appears in our catalog under these names: 2'-Hydroxy-6'-methoxychalcone, 95%, 2'-Hydroxy-6'-methoxychalcone, 2'-Hydroxy-6'-methoxychalcone, min. 95 %, 50 mg, 2'-Hydroxy-6'-methoxychalcone, min. 95 %, 100 mg, 2'-Hydroxy-6'-methoxychalcone, min. 95 %, 250 mg. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 250mg, 1g, 50mg, 100mg, 500mg.
(E)-1-(2-hydroxy-6-methoxyphenyl)-3-phenylprop-2-en-1-one (CAS 42079-68-5) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: (E)-1-(2-hydroxy-6-methoxyphenyl)-3-phenylprop-2-en-1-one. InChIKey: ZGXVPIGRFJUIEA-ZHACJKMWSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (E)-1-(2-hydroxy-6-methoxyphenyl)-3-phenylprop-2-en-1-one |
| InChIKey | ZGXVPIGRFJUIEA-ZHACJKMWSA-N |
| SMILES | COC1=CC=CC(=C1C(=O)/C=C/C2=CC=CC=C2)O |
Computed by PubChem (NCBI)