cas: 448211-44-7 — see every product listed under this CAS number, including other names
3-Methylcyclohex-1-ene-2-boronic acid pinacol ester, 96%, 96% (CAS 448211-44-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DDIR-100mg |
| cas | 448211-44-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1086.80 Pln | |
| Chemat | 250mg | 1696.40 Pln | |
| Chemat | 500mg | 2786.00 Pln | |
| Chemat | 1g | 4149.20 Pln | |
| Chemat | 5g | 12314.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(6-methylcyclohexen-1-yl)-1,3,2-dioxaborolane (CAS 448211-44-7) is a chemical compound with the molecular formula C13H23BO2 and a molecular weight of 222.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(6-methylcyclohexen-1-yl)-1,3,2-dioxaborolane. InChIKey: APVRBTBASYOFBD-UHFFFAOYSA-N.
| Molecular formula | C13H23BO2 |
|---|---|
| Molecular weight | 222.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(6-methylcyclohexen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | APVRBTBASYOFBD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCCC2C |
Computed by PubChem (NCBI)