cas: 273207-57-1 — see every product listed under this CAS number, including other names
3-Methylene-8-Boc-8-azabicyclo[3.2.1]octane, 97%, 97% (CAS 273207-57-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I679-100mg |
| cas | 273207-57-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 549.20 Pln | |
| Chemat | 1g | 1034.00 Pln | |
| Chemat | 5g | 2982.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-methylidene-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 273207-57-1) is a chemical compound with the molecular formula C13H21NO2 and a molecular weight of 223.31 g/mol. IUPAC name: tert-butyl 3-methylidene-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: ZYNYREKPRWPYDC-UHFFFAOYSA-N.
| Molecular formula | C13H21NO2 |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | tert-butyl 3-methylidene-8-azabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | ZYNYREKPRWPYDC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(=C)C2 |
Computed by PubChem (NCBI)