cas: 1421846-79-8 — see every product listed under this CAS number, including other names
3-Methylisoxazole-4-boronic Acid Pinacol Ester 98% (CAS 1421846-79-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A185144-100mg |
| cas | 1421846-79-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 681.88 Pln | |
| Ambeed | 250mg | 1316.00 Pln | |
| Ambeed | 1g | 2873.50 Pln | |
| Ambeed | 5g | 9331.56 Pln | |
| Ambeed | 10g | 17063.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A185144 |
3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole (CAS 1421846-79-8) is a chemical compound with the molecular formula C10H16BNO3 and a molecular weight of 209.05 g/mol. IUPAC name: 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole. InChIKey: ZHXDQNNFDJRLCZ-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO3 |
|---|---|
| Molecular weight | 209.05 g/mol |
| IUPAC name | 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole |
| InChIKey | ZHXDQNNFDJRLCZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CON=C2C |
Computed by PubChem (NCBI)