cas: 4085-18-1 — see every product listed under this CAS number, including other names
3-Nitro-[1,1'-biphenyl]-4-amine, ≥95%, ≥95% (CAS 4085-18-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CADP-1g |
| cas | 4085-18-1 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1245.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-nitro-4-phenylaniline (CAS 4085-18-1) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: 2-nitro-4-phenylaniline. InChIKey: MQDYZYVWFUIEQU-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 2-nitro-4-phenylaniline |
| InChIKey | MQDYZYVWFUIEQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)