cas: 4085-18-1 — see every product listed under this CAS number, including other names
3-Nitrobiphenyl-4-amine, 97% (CAS 4085-18-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633235-100MG |
| cas | 4085-18-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 601.89 Pln | |
| Fluorochem | 500mg | 846.59 Pln | |
| Fluorochem | 1g | 1164.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-nitro-4-phenylaniline (CAS 4085-18-1) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: 2-nitro-4-phenylaniline. InChIKey: MQDYZYVWFUIEQU-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 2-nitro-4-phenylaniline |
| InChIKey | MQDYZYVWFUIEQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)