cas: 4770-03-0 — see every product listed under this CAS number, including other names
3-Nitro-1H-indole, 97%, 97% (CAS 4770-03-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117ZQP-100mg |
| cas | 4770-03-0 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 717.20 Pln | |
| Chemat | 10g | 1163.60 Pln | |
| Chemat | 25g | 2493.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-nitro-1H-indole (CAS 4770-03-0) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 3-nitro-1H-indole. InChIKey: LSMXNZJFLGIPMS-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 3-nitro-1H-indole |
| InChIKey | LSMXNZJFLGIPMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)[N+](=O)[O-] |
Computed by PubChem (NCBI)