cas: 23612-33-1 — see every product listed under this CAS number, including other names
3-Nitro-1H-pyrrolo[3,2-b]pyridine 98% (CAS 23612-33-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A211825-10g |
| cas | 23612-33-1 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1538.50 Pln | |
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 314.75 Pln | |
| Ambeed | 5g | 882.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A211825 |
3-nitro-1H-pyrrolo[3,2-b]pyridine (CAS 23612-33-1) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 3-nitro-1H-pyrrolo[3,2-b]pyridine. InChIKey: FTRQCCAMRDXXGH-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 3-nitro-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | FTRQCCAMRDXXGH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN2)[N+](=O)[O-])N=C1 |
Computed by PubChem (NCBI)