cas: 23612-33-1 — see every product listed under this CAS number, including other names
3-Nitro-1H-pyrrolo[3,2-b]pyridine, 97% (CAS 23612-33-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F619288-250MG |
| cas | 23612-33-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 976.76 Pln | |
| Fluorochem | 10g | 1575.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-nitro-1H-pyrrolo[3,2-b]pyridine (CAS 23612-33-1) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 3-nitro-1H-pyrrolo[3,2-b]pyridine. InChIKey: FTRQCCAMRDXXGH-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 3-nitro-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | FTRQCCAMRDXXGH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN2)[N+](=O)[O-])N=C1 |
Computed by PubChem (NCBI)