cas: 23612-33-1 — see every product listed under this CAS number, including other names
3-Nitro-1H-pyrrolo[3,2-b]pyridine, 97%, 97% (CAS 23612-33-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113NWO-100mg |
| cas | 23612-33-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 731.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-nitro-1H-pyrrolo[3,2-b]pyridine (CAS 23612-33-1) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 3-nitro-1H-pyrrolo[3,2-b]pyridine. InChIKey: FTRQCCAMRDXXGH-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 3-nitro-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | FTRQCCAMRDXXGH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN2)[N+](=O)[O-])N=C1 |
Computed by PubChem (NCBI)