cas: 148777-84-8 — see every product listed under this CAS number, including other names
3-Nitro-4,5,6,7-tetrahydropyrazolo(1,5-a)pyrimidine, 97% (CAS 148777-84-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A529658-10g |
| cas | 148777-84-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 11019.82 Pln | |
| AmBeed | 5g | 7283.08 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-nitro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (CAS 148777-84-8) is a chemical compound with the molecular formula C6H8N4O2 and a molecular weight of 168.15 g/mol. IUPAC name: 3-nitro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine. InChIKey: NRYKSXYBFPTTGH-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O2 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 3-nitro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
| InChIKey | NRYKSXYBFPTTGH-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C=NN2C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)