CAS 21901-25-7 is the registry number for 2-Hydrazinyl-5-methyl-3-nitropyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
(5-methyl-3-nitro-2-pyridinyl)hydrazine (CAS 21901-25-7) is a chemical compound with the molecular formula C6H8N4O2 and a molecular weight of 168.15 g/mol. IUPAC name: (5-methyl-3-nitro-2-pyridinyl)hydrazine. InChIKey: XDMWWISPNLFVGD-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O2 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | (5-methyl-3-nitro-2-pyridinyl)hydrazine |
| InChIKey | XDMWWISPNLFVGD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)