Products 14233-44-4
CAS 14233-44-4 is the registry number for 2-Dimethylamino-5-nitropyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N,N-dimethyl-5-nitropyrimidin-2-amine (CAS 14233-44-4) is a chemical compound with the molecular formula C6H8N4O2 and a molecular weight of 168.15 g/mol. IUPAC name: N,N-dimethyl-5-nitropyrimidin-2-amine. InChIKey: IFFZVNFNYKKNFB-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O2 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | N,N-dimethyl-5-nitropyrimidin-2-amine |
| InChIKey | IFFZVNFNYKKNFB-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC=C(C=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)