cas: 393-80-6 — see every product listed under this CAS number, including other names
3-Nitro-4-(trifluoromethyl)aniline, 97%, 97% (CAS 393-80-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114805-50mg |
| cas | 393-80-6 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 102.80 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 2474.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-nitro-4-(trifluoromethyl)aniline (CAS 393-80-6) is a chemical compound with the molecular formula C7H5F3N2O2 and a molecular weight of 206.12 g/mol. IUPAC name: 3-nitro-4-(trifluoromethyl)aniline. InChIKey: ZDZNJYXHGWSWTN-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O2 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 3-nitro-4-(trifluoromethyl)aniline |
| InChIKey | ZDZNJYXHGWSWTN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)