cas: 377780-80-8 — see every product listed under this CAS number, including other names
3-Nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid 97% (CAS 377780-80-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A232486-100mg |
| cas | 377780-80-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 403.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A232486 |
3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 377780-80-8) is a chemical compound with the molecular formula C13H16BNO6 and a molecular weight of 293.08 g/mol. IUPAC name: 3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: OYMDMSRXMZRHPB-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO6 |
|---|---|
| Molecular weight | 293.08 g/mol |
| IUPAC name | 3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | OYMDMSRXMZRHPB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)