cas: 1032758-80-7 — see every product listed under this CAS number, including other names
3-Nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine, 98% (CAS 1032758-80-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212413-250MG |
| cas | 1032758-80-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 778.91 Pln | |
| Fluorochem | 5g | 3543.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 1032758-80-7) is a chemical compound with the molecular formula C11H16BN3O4 and a molecular weight of 265.08 g/mol. IUPAC name: 3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: HXMCKJVPNJJZTO-UHFFFAOYSA-N.
| Molecular formula | C11H16BN3O4 |
|---|---|
| Molecular weight | 265.08 g/mol |
| IUPAC name | 3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | HXMCKJVPNJJZTO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)