cas: 41253-01-4 — see every product listed under this CAS number, including other names
3-Nitro-5-iodobenzotrifluoride, 97% (CAS 41253-01-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 50mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A156725-5g |
| cas | 41253-01-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8363.74 Pln | |
| AmBeed | 10g | 10108.42 Pln | |
| Fluorochem | 50mg | 164.54 Pln | |
| Fluorochem | 250mg | 372.80 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-iodo-3-nitro-5-(trifluoromethyl)benzene (CAS 41253-01-4) is a chemical compound with the molecular formula C7H3F3INO2 and a molecular weight of 317.00 g/mol. IUPAC name: 1-iodo-3-nitro-5-(trifluoromethyl)benzene. InChIKey: BANTUHUNKDGMCA-UHFFFAOYSA-N.
| Molecular formula | C7H3F3INO2 |
|---|---|
| Molecular weight | 317.00 g/mol |
| IUPAC name | 1-iodo-3-nitro-5-(trifluoromethyl)benzene |
| InChIKey | BANTUHUNKDGMCA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])I)C(F)(F)F |
Computed by PubChem (NCBI)