CAS 1228898-12-1 appears in our catalog under these names: 2–Iodo–4–nitro–1–(trifluoromethyl)benzene, 2-Iodo-4-nitro-1-(trifluoromethyl)benzene, 95%, 2-Iodo-4-nitro-1-(trifluoromethyl)benzene 95%, 2-Iodo-4-nitro-1-(trifluoromethyl)benzene, 95%, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 25g, 100mg.
2-iodo-4-nitro-1-(trifluoromethyl)benzene (CAS 1228898-12-1) is a chemical compound with the molecular formula C7H3F3INO2 and a molecular weight of 317.00 g/mol. IUPAC name: 2-iodo-4-nitro-1-(trifluoromethyl)benzene. InChIKey: GXQIWTSUPAYASC-UHFFFAOYSA-N.
| Molecular formula | C7H3F3INO2 |
|---|---|
| Molecular weight | 317.00 g/mol |
| IUPAC name | 2-iodo-4-nitro-1-(trifluoromethyl)benzene |
| InChIKey | GXQIWTSUPAYASC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])I)C(F)(F)F |
Computed by PubChem (NCBI)