CAS 393-10-2 appears in our catalog under these names: 4-Iodo-1-nitro-2-(trifluoromethyl)benzene 95+%, 4-Iodo-1-nitro-2-(trifluoromethyl)benzene, 95%+, 95%+. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
4-iodo-1-nitro-2-(trifluoromethyl)benzene (CAS 393-10-2) is a chemical compound with the molecular formula C7H3F3INO2 and a molecular weight of 317.00 g/mol. IUPAC name: 4-iodo-1-nitro-2-(trifluoromethyl)benzene. InChIKey: RVEQXLQKLMGPHL-UHFFFAOYSA-N.
| Molecular formula | C7H3F3INO2 |
|---|---|
| Molecular weight | 317.00 g/mol |
| IUPAC name | 4-iodo-1-nitro-2-(trifluoromethyl)benzene |
| InChIKey | RVEQXLQKLMGPHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)