3-Nitrobenzenesulfonic acid hydrate, 97%
cas: 79326-96-8 — see every product listed under this CAS number, including other names
3-Nitrobenzenesulfonic acid hydrate, 97% (CAS 79326-96-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F465507-250MG |
| cas | 79326-96-8 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 513.38 Pln | |
| Fluorochem | 25g | 1788.97 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 498.31 Pln | |
| Ambeed | 25g | 1738.75 Pln | |
| BLDpharm | 250mg | 164.41 Pln | |
| BLDpharm | 1g | 197.73 Pln | |
| BLDpharm | 5g | 530.95 Pln | |
| BLDpharm | 25g | 1869.37 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
3-nitrobenzenesulfonic acid;hydrate (CAS 79326-96-8) is a chemical compound with the molecular formula C6H7NO6S and a molecular weight of 221.19 g/mol. IUPAC name: 3-nitrobenzenesulfonic acid;hydrate. InChIKey: PQEALYGHSZTSEQ-UHFFFAOYSA-N.
| Molecular formula | C6H7NO6S |
|---|---|
| Molecular weight | 221.19 g/mol |
| IUPAC name | 3-nitrobenzenesulfonic acid;hydrate |
| InChIKey | PQEALYGHSZTSEQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)O)[N+](=O)[O-].O |
Computed by PubChem (NCBI)