CAS 79326-96-8 appears in our catalog under these names: 3-Nitrobenzenesulfonic acid hydrate, 95%, 3-Nitrobenzenesulfonic acid hydrate 97%, 3-Nitrobenzenesulfonic acid hydrate, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg.
3-nitrobenzenesulfonic acid;hydrate (CAS 79326-96-8) is a chemical compound with the molecular formula C6H7NO6S and a molecular weight of 221.19 g/mol. IUPAC name: 3-nitrobenzenesulfonic acid;hydrate. InChIKey: PQEALYGHSZTSEQ-UHFFFAOYSA-N.
| Molecular formula | C6H7NO6S |
|---|---|
| Molecular weight | 221.19 g/mol |
| IUPAC name | 3-nitrobenzenesulfonic acid;hydrate |
| InChIKey | PQEALYGHSZTSEQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)O)[N+](=O)[O-].O |
Computed by PubChem (NCBI)