Products 152039-63-9

CAS 152039-63-9 is the registry number for 2-Nitrobenzenesulfonic acid hydrate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

2-nitrobenzenesulfonic acid;hydrate (CAS 152039-63-9) is a chemical compound with the molecular formula C6H7NO6S and a molecular weight of 221.19 g/mol. IUPAC name: 2-nitrobenzenesulfonic acid;hydrate. InChIKey: TYOGRNMVNYDSDK-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO6S
Molecular weight221.19 g/mol
IUPAC name2-nitrobenzenesulfonic acid;hydrate
InChIKeyTYOGRNMVNYDSDK-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)[N+](=O)[O-])S(=O)(=O)O.O

Computed by PubChem (NCBI)