CAS 121-51-7 appears in our catalog under these names: 3-Nitrobenzenesulfonyl chloride, 95%, 3-Nitrobenzenesulfonyl chloride, 98% , 3-Nitrobenzenesulfonyl Chloride, >98.0%(GC)(T), 3-Nitrobenzenesulfonyl chloride, 97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros), Fluorochem. Available pack sizes: 25g, 500g, 100g, 5g, 1g.
3-nitrobenzenesulfonyl chloride (CAS 121-51-7) is a chemical compound with the molecular formula C6H4ClNO4S and a molecular weight of 221.62 g/mol. IUPAC name: 3-nitrobenzenesulfonyl chloride. InChIKey: MWWNNNAOGWPTQY-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO4S |
|---|---|
| Molecular weight | 221.62 g/mol |
| IUPAC name | 3-nitrobenzenesulfonyl chloride |
| InChIKey | MWWNNNAOGWPTQY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)