CAS 57800-76-7 appears in our catalog under these names: 5-Chloro-4-nitrothiophene-2-carboxylic acid methyl ester, 97%, Methyl 5–Chloro–4–nitrothiophene–2–carboxylate, 5-Chloro-4-nitrothiophene-2-carboxylic acid methyl ester 95%, 5-Chloro-4-nitrothiophene-2-carboxylic acid methyl ester, 95%, 95%, METHYL 5-CHLORO-4-NITROTHIOPHENE-2-CARBOXYLATE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 100mg, 250mg, 100g.
Methyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS 57800-76-7) is a chemical compound with the molecular formula C6H4ClNO4S and a molecular weight of 221.62 g/mol. IUPAC name: methyl 5-chloro-4-nitrothiophene-2-carboxylate. InChIKey: IJSXVHIIYIMVTM-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO4S |
|---|---|
| Molecular weight | 221.62 g/mol |
| IUPAC name | methyl 5-chloro-4-nitrothiophene-2-carboxylate |
| InChIKey | IJSXVHIIYIMVTM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(S1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)