CAS 18598-74-8 appears in our catalog under these names: L-Isoleucine Methyl Ester Hydrochloride, 98%, 98%, 1-Azaspiro[4.5]decan-2-one, 98%, 98%, 2-(TOLUENE-4-SULFONYLAMINO)-BENZOIC ACID METHYL ESTER, 98%, 98%, 4-Nitrobenzenesulfonyl chloride, 98%, H-Ile-OMe·HCl 98%. Offered by: Chemat, Combi-blocks, Ambeed, Fluorochem, Chemat Brand. Available pack sizes: 10g, 25g, 500g, 5g, 1kg, 100mg, 250mg, 1g.
4-nitrobenzenesulfonyl chloride (CAS 98-74-8) is a chemical compound with the molecular formula C6H4ClNO4S and a molecular weight of 221.62 g/mol. IUPAC name: 4-nitrobenzenesulfonyl chloride. InChIKey: JXRGUPLJCCDGKG-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO4S |
|---|---|
| Molecular weight | 221.62 g/mol |
| IUPAC name | 4-nitrobenzenesulfonyl chloride |
| InChIKey | JXRGUPLJCCDGKG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])S(=O)(=O)Cl |
Computed by PubChem (NCBI)