CAS 50978-45-5 appears in our catalog under these names: N-Formylsaccharin, 95%, N–Formylsaccharin, N-Formylsaccharin, N-Formylsaccharin, >98.0%(GC), N-Formylsaccharin, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 100g, 5g, 25g, 1g, 10g, 50g, 250mg, 250g.
1,1,3-trioxo-1,2-benzothiazole-2-carbaldehyde (CAS 50978-45-5) is a chemical compound with the molecular formula C8H5NO4S and a molecular weight of 211.20 g/mol. IUPAC name: 1,1,3-trioxo-1,2-benzothiazole-2-carbaldehyde. InChIKey: LMPIFZSJKLLOLM-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4S |
|---|---|
| Molecular weight | 211.20 g/mol |
| IUPAC name | 1,1,3-trioxo-1,2-benzothiazole-2-carbaldehyde |
| InChIKey | LMPIFZSJKLLOLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(S2(=O)=O)C=O |
Computed by PubChem (NCBI)