N-Formylsaccharin, 95%, 95%
cas: 50978-45-5 — see every product listed under this CAS number, including other names
N-Formylsaccharin, 95%, 95% (CAS 50978-45-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AM9-250mg |
| cas | 50978-45-5 |
| size | 250mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 10g | 246.80 Pln | |
| Chemat | 25g | 477.20 Pln | |
| Chemat | 100g | 1370.00 Pln | |
| Chemat | 250g | 1677.20 Pln | |
| Chemat | 500g | 3076.80 Pln | |
| Chemat | 1kg | 5339.60 Pln | |
| Chemat | 50g | 818.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,1,3-trioxo-1,2-benzothiazole-2-carbaldehyde (CAS 50978-45-5) is a chemical compound with the molecular formula C8H5NO4S and a molecular weight of 211.20 g/mol. IUPAC name: 1,1,3-trioxo-1,2-benzothiazole-2-carbaldehyde. InChIKey: LMPIFZSJKLLOLM-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4S |
|---|---|
| Molecular weight | 211.20 g/mol |
| IUPAC name | 1,1,3-trioxo-1,2-benzothiazole-2-carbaldehyde |
| InChIKey | LMPIFZSJKLLOLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(S2(=O)=O)C=O |
Computed by PubChem (NCBI)