cas: 28495-72-9 — see every product listed under this CAS number, including other names
3-Pentanone p-Toluenesulfonylhydrazone, 95%, 95% (CAS 28495-72-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113VJ9-1g |
| cas | 28495-72-9 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 10g | 438.80 Pln | |
| Chemat | 25g | 746.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-methyl-N-(pentan-3-ylideneamino)benzenesulfonamide (CAS 28495-72-9) is a chemical compound with the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. IUPAC name: 4-methyl-N-(pentan-3-ylideneamino)benzenesulfonamide. InChIKey: GUEMDXLIHCONOI-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2S |
|---|---|
| Molecular weight | 254.35 g/mol |
| IUPAC name | 4-methyl-N-(pentan-3-ylideneamino)benzenesulfonamide |
| InChIKey | GUEMDXLIHCONOI-UHFFFAOYSA-N |
| SMILES | CCC(=NNS(=O)(=O)C1=CC=C(C=C1)C)CC |
Computed by PubChem (NCBI)