cas: 87873-72-1 — see every product listed under this CAS number, including other names
3-Phenoxyphenyl isocyanate (CAS 87873-72-1) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JV3-5mg |
| cas | 87873-72-1 |
| size | 5mg |
| availability | 0.025g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 194.00 Pln | |
| Chemat | 25mg | 352.40 Pln |
| delivery time | 3 weeks |
|---|
1-isocyanato-3-phenoxybenzene (CAS 87873-72-1) is a chemical compound with the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. IUPAC name: 1-isocyanato-3-phenoxybenzene. InChIKey: HOJSXCMKZBXNEN-UHFFFAOYSA-N.
| Molecular formula | C13H9NO2 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 1-isocyanato-3-phenoxybenzene |
| InChIKey | HOJSXCMKZBXNEN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)N=C=O |
Computed by PubChem (NCBI)