cas: 1171992-10-1 — see every product listed under this CAS number, including other names
3-Phenoxypiperidine hydrochloride 97% (CAS 1171992-10-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A147520-100mg |
| cas | 1171992-10-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 431.56 Pln | |
| Ambeed | 1g | 893.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A147520 |
3-phenoxypiperidine;hydrochloride (CAS 1171992-10-1) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 3-phenoxypiperidine;hydrochloride. InChIKey: NOIVAVLUDPXIBM-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 3-phenoxypiperidine;hydrochloride |
| InChIKey | NOIVAVLUDPXIBM-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)OC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)