cas: 329685-40-7 — see every product listed under this CAS number, including other names
3-Phenyl-1-propylboronic acid pinacol ester, ≥97%, ≥97% (CAS 329685-40-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JVB-100mg |
| cas | 329685-40-7 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 515.60 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(3-phenylpropyl)-1,3,2-dioxaborolane (CAS 329685-40-7) is a chemical compound with the molecular formula C15H23BO2 and a molecular weight of 246.15 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-phenylpropyl)-1,3,2-dioxaborolane. InChIKey: HRZOKAQQKKQUME-UHFFFAOYSA-N.
| Molecular formula | C15H23BO2 |
|---|---|
| Molecular weight | 246.15 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-phenylpropyl)-1,3,2-dioxaborolane |
| InChIKey | HRZOKAQQKKQUME-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCCC2=CC=CC=C2 |
Computed by PubChem (NCBI)