cas: 1225954-02-8 — see every product listed under this CAS number, including other names
3-Phenyl-2-(pyridin-2-yl)propan-1-amine, 97%, 97% (CAS 1225954-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AI62-100mg |
| cas | 1225954-02-8 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 712.40 Pln | |
| Chemat | 250mg | 1082.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-phenyl-2-pyridin-2-ylpropan-1-amine (CAS 1225954-02-8) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: 3-phenyl-2-pyridin-2-ylpropan-1-amine. InChIKey: JLFXXFICMQGLRU-UHFFFAOYSA-N.
| Molecular formula | C14H16N2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | 3-phenyl-2-pyridin-2-ylpropan-1-amine |
| InChIKey | JLFXXFICMQGLRU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(CN)C2=CC=CC=N2 |
Computed by PubChem (NCBI)