cas: 105558-52-9 — see every product listed under this CAS number, including other names
3-Phenyl-3-piperidinol hydrochloride, 95%, 95% (CAS 105558-52-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110T2P-100mg |
| cas | 105558-52-9 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 683.60 Pln | |
| Chemat | 1g | 1806.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-phenylpiperidin-3-ol;hydrochloride (CAS 105558-52-9) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 3-phenylpiperidin-3-ol;hydrochloride. InChIKey: OVASVBNMGKOUDN-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 3-phenylpiperidin-3-ol;hydrochloride |
| InChIKey | OVASVBNMGKOUDN-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)(C2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)