cas: 105558-52-9 — see every product listed under this CAS number, including other names
3-Phenylpiperidin-3-ol hydrochloride, 96% (CAS 105558-52-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A690087-5g |
| cas | 105558-52-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8363.74 Pln | |
| Fluorochem | 250mg | 659.16 Pln | |
| Fluorochem | 500mg | 1252.70 Pln | |
| Fluorochem | 1g | 1658.81 Pln |
| purity | 96% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-phenylpiperidin-3-ol;hydrochloride (CAS 105558-52-9) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 3-phenylpiperidin-3-ol;hydrochloride. InChIKey: OVASVBNMGKOUDN-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 3-phenylpiperidin-3-ol;hydrochloride |
| InChIKey | OVASVBNMGKOUDN-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)(C2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)