cas: 103012-26-6 — see every product listed under this CAS number, including other names
3-Phenyl-9H-carbazole 98% (CAS 103012-26-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A314615-250mg |
| cas | 103012-26-6 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 209.06 Pln | |
| Ambeed | 25g | 353.69 Pln | |
| Ambeed | 100g | 1171.38 Pln | |
| Ambeed | 500g | 5015.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A314615 |
3-phenyl-9H-carbazole (CAS 103012-26-6) is a chemical compound with the molecular formula C18H13N and a molecular weight of 243.3 g/mol. IUPAC name: 3-phenyl-9H-carbazole. InChIKey: IAWRFMPNMXEJCK-UHFFFAOYSA-N.
| Molecular formula | C18H13N |
|---|---|
| Molecular weight | 243.3 g/mol |
| IUPAC name | 3-phenyl-9H-carbazole |
| InChIKey | IAWRFMPNMXEJCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)NC4=CC=CC=C43 |
Computed by PubChem (NCBI)