CAS 789-47-9 appears in our catalog under these names: 2-Aminochrysene, 97%, 2-Aminochrysene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 50g.
Chrysen-2-amine (CAS 789-47-9) is a chemical compound with the molecular formula C18H13N and a molecular weight of 243.3 g/mol. IUPAC name: chrysen-2-amine. InChIKey: KSDIHKMNSYWRFB-UHFFFAOYSA-N.
| Molecular formula | C18H13N |
|---|---|
| Molecular weight | 243.3 g/mol |
| IUPAC name | chrysen-2-amine |
| InChIKey | KSDIHKMNSYWRFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC4=C3C=CC(=C4)N |
Computed by PubChem (NCBI)