CAS 104636-53-5 appears in our catalog under these names: 1–phenyl–9H–carbazole, 1-Phenyl-9H-carbazole, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
1-phenyl-9H-carbazole (CAS 104636-53-5) is a chemical compound with the molecular formula C18H13N and a molecular weight of 243.3 g/mol. IUPAC name: 1-phenyl-9H-carbazole. InChIKey: FBTOLQFRGURPJH-UHFFFAOYSA-N.
| Molecular formula | C18H13N |
|---|---|
| Molecular weight | 243.3 g/mol |
| IUPAC name | 1-phenyl-9H-carbazole |
| InChIKey | FBTOLQFRGURPJH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC3=C2NC4=CC=CC=C34 |
Computed by PubChem (NCBI)