Products 138713-44-7

CAS 138713-44-7 appears in our catalog under these names: 3–Phenylmorpholine, 3-Phenyl-morpholine, 3-Phenylmorpholine, 97%, 97%, 3-Phenyl-morpholine, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 1g, 5g, 100mg.

Structural formula: {0} (CAS {1})

3-phenylmorpholine (CAS 138713-44-7) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: 3-phenylmorpholine. InChIKey: MHZXKVPCJBPNKI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO
Molecular weight163.22 g/mol
IUPAC name3-phenylmorpholine
InChIKeyMHZXKVPCJBPNKI-UHFFFAOYSA-N
SMILESC1COCC(N1)C2=CC=CC=C2

Computed by PubChem (NCBI)