Products 914299-79-9
CAS 914299-79-9 appears in our catalog under these names: (S)-3-Phenylmorpholine, 98%, (S)–3–Phenylmorpholine, (S)-3-Phenylmorpholine 98%, (S)-3-Phenylmorpholine, 98%, 98%, (S)-3-Phenylmorpholine, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g, 25g, 50g.
(3S)-3-phenylmorpholine (CAS 914299-79-9) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: (3S)-3-phenylmorpholine. InChIKey: MHZXKVPCJBPNKI-SNVBAGLBSA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | (3S)-3-phenylmorpholine |
| InChIKey | MHZXKVPCJBPNKI-SNVBAGLBSA-N |
| SMILES | C1COC[C@@H](N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)