cas: 562803-68-3 — see every product listed under this CAS number, including other names
3-Pyrazol-1-ylmethyl-benzoic acid, 97% (CAS 562803-68-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F028242-1G |
| cas | 562803-68-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 737.26 Pln | |
| Fluorochem | 5g | 2059.71 Pln | |
| Fluorochem | 25g | 6016.65 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(pyrazol-1-ylmethyl)benzoic acid (CAS 562803-68-3) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 3-(pyrazol-1-ylmethyl)benzoic acid. InChIKey: UMYNAPRDOSIHOY-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 3-(pyrazol-1-ylmethyl)benzoic acid |
| InChIKey | UMYNAPRDOSIHOY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CN2C=CC=N2 |
Computed by PubChem (NCBI)