cas: 885465-97-4 — see every product listed under this CAS number, including other names
3-Thiazol-2-yl-benzaldehyde (CAS 885465-97-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119BTL-1g |
| cas | 885465-97-4 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1830.80 Pln |
| delivery time | 3 weeks |
|---|
3-(1,3-thiazol-2-yl)benzaldehyde (CAS 885465-97-4) is a chemical compound with the molecular formula C10H7NOS and a molecular weight of 189.24 g/mol. IUPAC name: 3-(1,3-thiazol-2-yl)benzaldehyde. InChIKey: YJMGIEKCDQXKKZ-UHFFFAOYSA-N.
| Molecular formula | C10H7NOS |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 3-(1,3-thiazol-2-yl)benzaldehyde |
| InChIKey | YJMGIEKCDQXKKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NC=CS2)C=O |
Computed by PubChem (NCBI)