cas: 1008380-11-7 — see every product listed under this CAS number, including other names
3-Thiazolidineacetic acid, 5-((4-methylphenyl)amino)-2,4-dioxo-, 97% (CAS 1008380-11-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A658233-5g |
| cas | 1008380-11-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10648.75 Pln | |
| AmBeed | 10g | 14880.25 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[5-(4-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (CAS 1008380-11-7) is a chemical compound with the molecular formula C12H12N2O4S and a molecular weight of 280.30 g/mol. IUPAC name: 2-[5-(4-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid. InChIKey: ADTBADZKVHGQJQ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4S |
|---|---|
| Molecular weight | 280.30 g/mol |
| IUPAC name | 2-[5-(4-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| InChIKey | ADTBADZKVHGQJQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2C(=O)N(C(=O)S2)CC(=O)O |
Computed by PubChem (NCBI)