CAS 1443978-43-5 is the registry number for 2-Benzyl-5-methyl-2h-1,2,6-thiadiazine-4-carboxylic acid 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-benzyl-5-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid (CAS 1443978-43-5) is a chemical compound with the molecular formula C12H12N2O4S and a molecular weight of 280.30 g/mol. IUPAC name: 2-benzyl-5-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid. InChIKey: ZSFXSXJAMAJXAW-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4S |
|---|---|
| Molecular weight | 280.30 g/mol |
| IUPAC name | 2-benzyl-5-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid |
| InChIKey | ZSFXSXJAMAJXAW-UHFFFAOYSA-N |
| SMILES | CC1=NS(=O)(=O)N(C=C1C(=O)O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)