Products 1443978-43-5

CAS 1443978-43-5 is the registry number for 2-Benzyl-5-methyl-2h-1,2,6-thiadiazine-4-carboxylic acid 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-benzyl-5-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid (CAS 1443978-43-5) is a chemical compound with the molecular formula C12H12N2O4S and a molecular weight of 280.30 g/mol. IUPAC name: 2-benzyl-5-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid. InChIKey: ZSFXSXJAMAJXAW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12N2O4S
Molecular weight280.30 g/mol
IUPAC name2-benzyl-5-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid
InChIKeyZSFXSXJAMAJXAW-UHFFFAOYSA-N
SMILESCC1=NS(=O)(=O)N(C=C1C(=O)O)CC2=CC=CC=C2

Computed by PubChem (NCBI)