CAS 1008380-11-7 appears in our catalog under these names: (5-[(4-Methylphenyl)amino]-2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid, 95%, 3-Thiazolidineacetic acid, 5-((4-methylphenyl)amino)-2,4-dioxo-, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
2-[5-(4-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (CAS 1008380-11-7) is a chemical compound with the molecular formula C12H12N2O4S and a molecular weight of 280.30 g/mol. IUPAC name: 2-[5-(4-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid. InChIKey: ADTBADZKVHGQJQ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4S |
|---|---|
| Molecular weight | 280.30 g/mol |
| IUPAC name | 2-[5-(4-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| InChIKey | ADTBADZKVHGQJQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2C(=O)N(C(=O)S2)CC(=O)O |
Computed by PubChem (NCBI)