cas: 43012-47-1 — see every product listed under this CAS number, including other names
3-amino-1,3-dihydro-2H-indol-2-one hydrochloride, 97% (CAS 43012-47-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F359126-1G |
| cas | 43012-47-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3225.97 Pln | |
| Fluorochem | 5g | 11775.04 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-amino-1,3-dihydroindol-2-one;hydrochloride (CAS 43012-47-1) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 3-amino-1,3-dihydroindol-2-one;hydrochloride. InChIKey: UWVYGNLXGHBQNO-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 3-amino-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | UWVYGNLXGHBQNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(=O)N2)N.Cl |
Computed by PubChem (NCBI)