CAS 43012-47-1 appears in our catalog under these names: 3-Amino-1,3-dihydro-2h-indol-2-one hydrochloride, 98%, 3-Amino-2,3-dihydro-1H-indol-2-one hydrochloride, 3-amino-1,3-dihydro-2H-indol-2-one hydrochloride, 97%, 97%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
3-amino-1,3-dihydroindol-2-one;hydrochloride (CAS 43012-47-1) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 3-amino-1,3-dihydroindol-2-one;hydrochloride. InChIKey: UWVYGNLXGHBQNO-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 3-amino-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | UWVYGNLXGHBQNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(=O)N2)N.Cl |
Computed by PubChem (NCBI)