Products 1233698-83-3
CAS 1233698-83-3 is the registry number for 6-Chloro-2-(dimethylamino)nicotinaldehyde, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
6-chloro-2-(dimethylamino)pyridine-3-carbaldehyde (CAS 1233698-83-3) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 6-chloro-2-(dimethylamino)pyridine-3-carbaldehyde. InChIKey: WLAKXRIJWJOYQI-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 6-chloro-2-(dimethylamino)pyridine-3-carbaldehyde |
| InChIKey | WLAKXRIJWJOYQI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=CC(=N1)Cl)C=O |
Computed by PubChem (NCBI)